C18H26N4O2 — CID 2467512
1-cyclohexyl-3-[(4-morpholin-4-ylphenyl)methylideneamino]urea (PubChem CID 2467512) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(4-morpholin-4-ylphenyl)methylideneamino]urea.
| Compound Name | 1-cyclohexyl-3-[(4-morpholin-4-ylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 2467512 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-cyclohexyl-3-[(4-morpholin-4-ylphenyl)methylideneamino]urea |
| SMILES | O=C(NN=Cc1ccc(N2CCOCC2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H26N4O2/c23-18(20-16-4-2-1-3-5-16)21-19-14-15-6-8-17(9-7-15)22-10-12-24-13-11-22/h6-9,14,16H,1-5,10-13H2,(H2,20,21,23) |
| InChIKey | FCPLMMTWULFROT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|