C22H18N2O5S — CID 4123383
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 4123383) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4123383 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc2c(c1)OCO2)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H18N2O5S/c1-14(21(26)24-22-23-17(12-30-22)16-5-3-2-4-6-16)29-20(25)10-8-15-7-9-18-19(11-15)28-13-27-18/h2-12,14H,13H2,1H3,(H,23,24,26) |
| InChIKey | MKRHZMYYCIMOGP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|