C23H22N2O5S — CID 6151609
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 6151609) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6151609 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC(C)C(=O)Nc2nc(-c3ccccc3)cs2)cc1OC |
| InChI | InChI=1S/C23H22N2O5S/c1-15(22(27)25-23-24-18(14-31-23)17-7-5-4-6-8-17)30-21(26)12-10-16-9-11-19(28-2)20(13-16)29-3/h4-15H,1-3H3,(H,24,25,27)/b12-10+ |
| InChIKey | VEIWIULWHHFQJE-ZRDIBKRKSA-N |
| XLogP | 4.41 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|