C12H8BrF3N2O2S — CID 87665224
2-bromo-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 87665224) has the molecular formula C12H8BrF3N2O2S and a molecular weight of 381.17 g/mol. Its IUPAC name is 2-bromo-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-bromo-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87665224 |
| Molecular Formula | C12H8BrF3N2O2S |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 2-bromo-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CBr)Nc1nc(-c2ccc(OC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C12H8BrF3N2O2S/c13-5-10(19)18-11-17-9(6-21-11)7-1-3-8(4-2-7)20-12(14,15)16/h1-4,6H,5H2,(H,17,18,19) |
| InChIKey | XIGWAOOKTUIPHC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|