C13H8BrF5N2O2S — CID 86662193
2-bromo-N-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 86662193) has the molecular formula C13H8BrF5N2O2S and a molecular weight of 431.18 g/mol. Its IUPAC name is 2-bromo-N-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-bromo-N-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 86662193 |
| Molecular Formula | C13H8BrF5N2O2S |
| Molecular Weight | 431.18 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 2-bromo-N-[4-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CBr)Nc1nc(-c2cc(F)c(OCC(F)(F)F)c(F)c2)cs1 |
| InChI | InChI=1S/C13H8BrF5N2O2S/c14-3-10(22)21-12-20-9(4-24-12)6-1-7(15)11(8(16)2-6)23-5-13(17,18)19/h1-2,4H,3,5H2,(H,20,21,22) |
| InChIKey | QILKPVWUQNGMHJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.18 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|