C19H14BrF5N2O2S — CID 91461354
2-bromo-1-[[4-[3,5-difluoro-4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]amino]ethanol (PubChem CID 91461354) has the molecular formula C19H14BrF5N2O2S and a molecular weight of 509.29 g/mol. Its IUPAC name is 2-bromo-1-[[4-[3,5-difluoro-4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]amino]ethanol.
| Compound Name | 2-bromo-1-[[4-[3,5-difluoro-4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 91461354 |
| Molecular Formula | C19H14BrF5N2O2S |
| Molecular Weight | 509.29 g/mol |
| Exact Mass | 507.99 |
| IUPAC Name | 2-bromo-1-[[4-[3,5-difluoro-4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]amino]ethanol |
| SMILES | OC(CBr)Nc1nc(-c2cc(F)c(OCc3ccccc3C(F)(F)F)c(F)c2)cs1 |
| InChI | InChI=1S/C19H14BrF5N2O2S/c20-7-16(28)27-18-26-15(9-30-18)11-5-13(21)17(14(22)6-11)29-8-10-3-1-2-4-12(10)19(23,24)25/h1-6,9,16,28H,7-8H2,(H,26,27) |
| InChIKey | ZVUWJPUHXWZALO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.29 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|