C17H19F3N2O2S2 — CID 90681247
7-sulfanyl-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]heptanamide (PubChem CID 90681247) has the molecular formula C17H19F3N2O2S2 and a molecular weight of 404.48 g/mol. Its IUPAC name is 7-sulfanyl-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]heptanamide.
| Compound Name | 7-sulfanyl-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 90681247 |
| Molecular Formula | C17H19F3N2O2S2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 7-sulfanyl-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]heptanamide |
| SMILES | O=C(CCCCCCS)Nc1nc(-c2ccc(OC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C17H19F3N2O2S2/c18-17(19,20)24-13-8-6-12(7-9-13)14-11-26-16(21-14)22-15(23)5-3-1-2-4-10-25/h6-9,11,25H,1-5,10H2,(H,21,22,23) |
| InChIKey | GYXDDACJRSGRMV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|