C22H20Cl2N2O2S — CID 5203328
N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 5203328) has the molecular formula C22H20Cl2N2O2S and a molecular weight of 447.39 g/mol. Its IUPAC name is N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5203328 |
| Molecular Formula | C22H20Cl2N2O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-[4-(4-butoxyphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2csc(NC(=O)C=Cc3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O2S/c1-2-3-12-28-17-8-6-16(7-9-17)20-14-29-22(25-20)26-21(27)11-5-15-4-10-18(23)19(24)13-15/h4-11,13-14H,2-3,12H2,1H3,(H,25,26,27) |
| InChIKey | HJACWGVNVVHNOV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|