C29H27ClN2O4S — CID 19226922
(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 19226922) has the molecular formula C29H27ClN2O4S and a molecular weight of 535.07 g/mol. Its IUPAC name is (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19226922 |
| Molecular Formula | C29H27ClN2O4S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1ccc(-c2nc(NC(=O)/C=C/c3ccc(OCc4ccc(Cl)cc4)c(OC)c3)sc2C)cc1 |
| InChI | InChI=1S/C29H27ClN2O4S/c1-4-35-24-13-9-22(10-14-24)28-19(2)37-29(32-28)31-27(33)16-8-20-7-15-25(26(17-20)34-3)36-18-21-5-11-23(30)12-6-21/h5-17H,4,18H2,1-3H3,(H,31,32,33)/b16-8+ |
| InChIKey | SFDKXYOHDZCFBF-LZYBPNLTSA-N |
| XLogP | 7.41 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|