C19H18Cl2N2O4S — CID 30390267
(E)-N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 30390267) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is (E)-N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30390267 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (E)-N-[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-27-18-8-7-15(28(25,26)23-14-5-6-14)11-17(18)22-19(24)9-3-12-2-4-13(20)10-16(12)21/h2-4,7-11,14,23H,5-6H2,1H3,(H,22,24)/b9-3+ |
| InChIKey | VDMMTUSRUXHXQG-YCRREMRBSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|