C20H23N3O6S — CID 6043889
(E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 6043889) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6043889 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (E)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-4-22(5-2)30(27,28)17-11-12-19(29-3)18(14-17)21-20(24)13-8-15-6-9-16(10-7-15)23(25)26/h6-14H,4-5H2,1-3H3,(H,21,24)/b13-8+ |
| InChIKey | RVUMNMMWTZOIRW-MDWZMJQESA-N |
| XLogP | 3.29 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|