C26H42N2O5 — CID 21337217
N-butyl-4-[4-[(E)-3-[hydroxy(octyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenoxy]butanamide (PubChem CID 21337217) has the molecular formula C26H42N2O5 and a molecular weight of 462.63 g/mol. Its IUPAC name is N-butyl-4-[4-[(E)-3-[hydroxy(octyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenoxy]butanamide.
| Compound Name | N-butyl-4-[4-[(E)-3-[hydroxy(octyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenoxy]butanamide |
|---|---|
| PubChem CID | 21337217 |
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | N-butyl-4-[4-[(E)-3-[hydroxy(octyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenoxy]butanamide |
| SMILES | CCCCCCCCN(O)C(=O)/C=C/c1ccc(OCCCC(=O)NCCCC)c(OC)c1 |
| InChI | InChI=1S/C26H42N2O5/c1-4-6-8-9-10-11-19-28(31)26(30)17-15-22-14-16-23(24(21-22)32-3)33-20-12-13-25(29)27-18-7-5-2/h14-17,21,31H,4-13,18-20H2,1-3H3,(H,27,29)/b17-15+ |
| InChIKey | XPOHVVCHWHLMLD-BMRADRMJSA-N |
| XLogP | 5.36 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|