C23H21N3O5S — CID 55737633
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 55737633) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55737633 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc(OCc2ccccn2)cc1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C23H21N3O5S/c1-15(22(29)26-23-19(21(24)28)11-13-32-23)31-20(27)10-7-16-5-8-18(9-6-16)30-14-17-4-2-3-12-25-17/h2-13,15H,14H2,1H3,(H2,24,28)(H,26,29) |
| InChIKey | RAGURZZIBPYAKQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|