C16H15BrN2O5S — CID 55419469
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenoxy)acetate (PubChem CID 55419469) has the molecular formula C16H15BrN2O5S and a molecular weight of 427.28 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenoxy)acetate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 55419469 |
| Molecular Formula | C16H15BrN2O5S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(Br)cc1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H15BrN2O5S/c1-9(15(22)19-16-12(14(18)21)6-7-25-16)24-13(20)8-23-11-4-2-10(17)3-5-11/h2-7,9H,8H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | JLZDDKQGSZYCNF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |