C16H15BrN2O4S — CID 55416907
[1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate (PubChem CID 55416907) has the molecular formula C16H15BrN2O4S and a molecular weight of 411.28 g/mol. Its IUPAC name is [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate.
| Compound Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 55416907 |
| Molecular Formula | C16H15BrN2O4S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 2-(4-bromophenyl)acetate |
| SMILES | CC(OC(=O)Cc1ccc(Br)cc1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H15BrN2O4S/c1-9(15(22)19-16-12(14(18)21)6-7-24-16)23-13(20)8-10-2-4-11(17)5-3-10/h2-7,9H,8H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | LUYPUGSUUZPQHM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |