C15H16N2O5S — CID 27506728
[(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-(furan-2-yl)propanoate (PubChem CID 27506728) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-(furan-2-yl)propanoate.
| Compound Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 27506728 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(2S)-1-[(3-carbamoylthiophen-2-yl)amino]-1-oxopropan-2-yl] 3-(furan-2-yl)propanoate |
| SMILES | C[C@H](OC(=O)CCc1ccco1)C(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H16N2O5S/c1-9(22-12(18)5-4-10-3-2-7-21-10)14(20)17-15-11(13(16)19)6-8-23-15/h2-3,6-9H,4-5H2,1H3,(H2,16,19)(H,17,20)/t9-/m0/s1 |
| InChIKey | XWIVQUXHPNZWNT-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |