C18H17FN2O4 — CID 7796305
[(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)acetate (PubChem CID 7796305) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)acetate.
| Compound Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7796305 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(2S)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 2-(2-fluorophenyl)acetate |
| SMILES | C[C@H](OC(=O)Cc1ccccc1F)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H17FN2O4/c1-11(25-16(22)10-13-4-2-3-5-15(13)19)18(24)21-14-8-6-12(7-9-14)17(20)23/h2-9,11H,10H2,1H3,(H2,20,23)(H,21,24)/t11-/m0/s1 |
| InChIKey | IWTDZWCPVCCLLR-NSHDSACASA-N |
| XLogP | 2.04 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |