C19H26N2O6S — CID 55440480
propan-2-yl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 55440480) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 55440480 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H26N2O6S/c1-15(2)27-19(23)9-10-20-18(22)8-5-16-3-6-17(7-4-16)28(24,25)21-11-13-26-14-12-21/h3-8,15H,9-14H2,1-2H3,(H,20,22)/b8-5+ |
| InChIKey | BCVZVYPWIRXHBL-VMPITWQZSA-N |
| XLogP | 1.18 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|