C28H36N2O5S — CID 5078177
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 5078177) has the molecular formula C28H36N2O5S and a molecular weight of 512.67 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5078177 |
| Molecular Formula | C28H36N2O5S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)C=Cc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C28H36N2O5S/c1-28(2,3)30(21-24-11-7-6-8-12-24)26(31)22-35-27(32)18-15-23-13-16-25(17-14-23)36(33,34)29-19-9-4-5-10-20-29/h6-8,11-18H,4-5,9-10,19-22H2,1-3H3 |
| InChIKey | XUNBSVFCMXEIHD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|