C32H26N4O7 — CID 23802628
[2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate (PubChem CID 23802628) has the molecular formula C32H26N4O7 and a molecular weight of 578.58 g/mol. Its IUPAC name is [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate.
| Compound Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 23802628 |
| Molecular Formula | C32H26N4O7 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [2-(2-methyl-5-nitroanilino)-2-oxoethyl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)OCC(=O)Nc4cc([N+](=O)[O-])ccc4C)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H26N4O7/c1-19-4-10-23(36(39)40)17-27(19)33-29(37)18-43-32(38)22-9-15-26-28(16-22)35-31(21-7-13-25(42-3)14-8-21)30(34-26)20-5-11-24(41-2)12-6-20/h4-17H,18H2,1-3H3,(H,33,37) |
| InChIKey | CEFSSEYHDKDBEU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|