C21H22ClNO7 — CID 42486896
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate (PubChem CID 42486896) has the molecular formula C21H22ClNO7 and a molecular weight of 435.86 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 42486896 |
| Molecular Formula | C21H22ClNO7 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)OCC(=O)Nc2ccccc2C(=O)OC)cc1OC |
| InChI | InChI=1S/C21H22ClNO7/c1-4-9-29-19-15(22)10-13(11-17(19)27-2)20(25)30-12-18(24)23-16-8-6-5-7-14(16)21(26)28-3/h5-8,10-11H,4,9,12H2,1-3H3,(H,23,24) |
| InChIKey | RWBDYVQQMUIUCP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |