C20H20ClF2NO5S — CID 42402230
[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate (PubChem CID 42402230) has the molecular formula C20H20ClF2NO5S and a molecular weight of 459.90 g/mol. Its IUPAC name is [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate.
| Compound Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 42402230 |
| Molecular Formula | C20H20ClF2NO5S |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 3-chloro-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Cl)cc(C(=O)OCC(=O)Nc2ccccc2SC(F)F)cc1OC |
| InChI | InChI=1S/C20H20ClF2NO5S/c1-3-8-28-18-13(21)9-12(10-15(18)27-2)19(26)29-11-17(25)24-14-6-4-5-7-16(14)30-20(22)23/h4-7,9-10,20H,3,8,11H2,1-2H3,(H,24,25) |
| InChIKey | HEQHMBBJZUBGQO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |