C24H20N4O5S — CID 55522222
[2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 6-pyrazol-1-ylpyridine-3-carboxylate (PubChem CID 55522222) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 6-pyrazol-1-ylpyridine-3-carboxylate.
| Compound Name | [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55522222 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | [2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxoethyl] 6-pyrazol-1-ylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COC(=O)c1ccc(-n2cccn2)nc1 |
| InChI | InChI=1S/C24H20N4O5S/c1-2-32-24(31)21-18(16-7-4-3-5-8-16)15-34-22(21)27-20(29)14-33-23(30)17-9-10-19(25-13-17)28-12-6-11-26-28/h3-13,15H,2,14H2,1H3,(H,27,29) |
| InChIKey | VHQURRSXMHBVAZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|