C18H11Cl4NO3S — CID 71027929
2-[(2,4-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylic acid (PubChem CID 71027929) has the molecular formula C18H11Cl4NO3S and a molecular weight of 463.17 g/mol. Its IUPAC name is 2-[(2,4-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(2,4-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 71027929 |
| Molecular Formula | C18H11Cl4NO3S |
| Molecular Weight | 463.17 g/mol |
| Exact Mass | 460.92 |
| IUPAC Name | 2-[(2,4-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]-4-(2,4-dichlorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc(Cl)cc2Cl)csc1NC(=O)C1CC=C(Cl)C=C1Cl |
| InChI | InChI=1S/C18H11Cl4NO3S/c19-8-1-3-10(13(21)5-8)12-7-27-17(15(12)18(25)26)23-16(24)11-4-2-9(20)6-14(11)22/h1-3,5-7,11H,4H2,(H,23,24)(H,25,26) |
| InChIKey | XNHCWHJBRWGASN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.17 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|