C19H12ClN3O4S — CID 89458366
4-(4-chlorophenyl)-2-[(1-oxido-2H-benzimidazol-1-ium-5-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 89458366) has the molecular formula C19H12ClN3O4S and a molecular weight of 413.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(1-oxido-2H-benzimidazol-1-ium-5-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[(1-oxido-2H-benzimidazol-1-ium-5-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458366 |
| Molecular Formula | C19H12ClN3O4S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(1-oxido-2H-benzimidazol-1-ium-5-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1ccc2c(c1)=NC[N+]=2[O-] |
| InChI | InChI=1S/C19H12ClN3O4S/c20-12-4-1-10(2-5-12)13-8-28-18(16(13)19(25)26)22-17(24)11-3-6-15-14(7-11)21-9-23(15)27/h1-8H,9H2,(H,22,24)(H,25,26) |
| InChIKey | HVHPUOIENLEFMQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|