C34H30ClFN4O4S — CID 19305223
N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19305223) has the molecular formula C34H30ClFN4O4S and a molecular weight of 645.16 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305223 |
| Molecular Formula | C34H30ClFN4O4S |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-acetamidoanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(2-chloro-6-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2c(F)cccc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C34H30ClFN4O4S/c1-3-31(34(44)38-24-17-15-23(16-18-24)37-21(2)41)45-26-12-7-11-25(19-26)39-33(43)30(20-27-28(35)13-8-14-29(27)36)40-32(42)22-9-5-4-6-10-22/h4-20,31H,3H2,1-2H3,(H,37,41)(H,38,44)(H,39,43)(H,40,42)/b30-20+ |
| InChIKey | LSHBNCDQSJGAJL-TWKHWXDSSA-N |
| XLogP | 7.36 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|