C25H27N3O6S2 — CID 18902863
3,4-dimethoxy-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18902863) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18902863 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[1-oxo-1-(4-sulfamoylanilino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc(OC)c(OC)c2)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H27N3O6S2/c1-4-23(25(30)27-17-9-11-20(12-10-17)36(26,31)32)35-19-7-5-6-18(15-19)28-24(29)16-8-13-21(33-2)22(14-16)34-3/h5-15,23H,4H2,1-3H3,(H,27,30)(H,28,29)(H2,26,31,32) |
| InChIKey | BHHVWHZFGHELEV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |