C24H19ClF3N3O4S — CID 18905421
N-[3-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18905421) has the molecular formula C24H19ClF3N3O4S and a molecular weight of 537.95 g/mol. Its IUPAC name is N-[3-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18905421 |
| Molecular Formula | C24H19ClF3N3O4S |
| Molecular Weight | 537.95 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | N-[3-[1-[4-chloro-2-(trifluoromethyl)anilino]-1-oxobutan-2-yl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccc([N+](=O)[O-])cc2)c1)C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C24H19ClF3N3O4S/c1-2-21(23(33)30-20-11-8-15(25)12-19(20)24(26,27)28)36-18-5-3-4-16(13-18)29-22(32)14-6-9-17(10-7-14)31(34)35/h3-13,21H,2H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | LNCDPOFKVVSMAO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.95 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|