C20H22N4O2S2 — CID 18894614
N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-(3-aminophenyl)sulfanylbutanamide (PubChem CID 18894614) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-(3-aminophenyl)sulfanylbutanamide.
| Compound Name | N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-(3-aminophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 18894614 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(6-acetyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-(3-aminophenyl)sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(N)c1)C(=O)Nc1sc2c(c1C#N)CCN(C(C)=O)C2 |
| InChI | InChI=1S/C20H22N4O2S2/c1-3-17(27-14-6-4-5-13(22)9-14)19(26)23-20-16(10-21)15-7-8-24(12(2)25)11-18(15)28-20/h4-6,9,17H,3,7-8,11,22H2,1-2H3,(H,23,26) |
| InChIKey | AAIQNYDFNWFVAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|