C32H31N5OS3 — CID 19317473
N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide (PubChem CID 19317473) has the molecular formula C32H31N5OS3 and a molecular weight of 597.84 g/mol. Its IUPAC name is N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide.
| Compound Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19317473 |
| Molecular Formula | C32H31N5OS3 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1sc2c(c1C#N)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C32H31N5OS3/c1-2-28(40-25-15-9-14-24(18-25)35-32(39)34-23-12-7-4-8-13-23)30(38)36-31-27(19-33)26-16-17-37(21-29(26)41-31)20-22-10-5-3-6-11-22/h3-15,18,28H,2,16-17,20-21H2,1H3,(H,36,38)(H2,34,35,39) |
| InChIKey | XUVUIZJBNWGPCK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|