C27H22N4OS3 — CID 19317591
N-(3-cyano-4-phenylthiophen-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetamide (PubChem CID 19317591) has the molecular formula C27H22N4OS3 and a molecular weight of 514.70 g/mol. Its IUPAC name is N-(3-cyano-4-phenylthiophen-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetamide.
| Compound Name | N-(3-cyano-4-phenylthiophen-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19317591 |
| Molecular Formula | C27H22N4OS3 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-(3-cyano-4-phenylthiophen-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3scc(-c4ccccc4)c3C#N)c2)cc1 |
| InChI | InChI=1S/C27H22N4OS3/c1-18-10-12-20(13-11-18)29-27(33)30-21-8-5-9-22(14-21)34-17-25(32)31-26-23(15-28)24(16-35-26)19-6-3-2-4-7-19/h2-14,16H,17H2,1H3,(H,31,32)(H2,29,30,33) |
| InChIKey | YKFGQNADWXPOLL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|