C36H27N5O5S2 — CID 19322396
N-[(E)-3-[3-[2-[[3-cyano-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19322396) has the molecular formula C36H27N5O5S2 and a molecular weight of 673.78 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[[3-cyano-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[[3-cyano-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19322396 |
| Molecular Formula | C36H27N5O5S2 |
| Molecular Weight | 673.78 g/mol |
| Exact Mass | 673.15 |
| IUPAC Name | N-[(E)-3-[3-[2-[[3-cyano-4-(4-methylphenyl)thiophen-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3cccc(NC(=O)/C(=C\c4ccccc4[N+](=O)[O-])NC(=O)c4ccccc4)c3)c2C#N)cc1 |
| InChI | InChI=1S/C36H27N5O5S2/c1-23-14-16-24(17-15-23)30-21-48-36(29(30)20-37)40-33(42)22-47-28-12-7-11-27(19-28)38-35(44)31(39-34(43)25-8-3-2-4-9-25)18-26-10-5-6-13-32(26)41(45)46/h2-19,21H,22H2,1H3,(H,38,44)(H,39,43)(H,40,42)/b31-18+ |
| InChIKey | BITHYNDEQGBTHO-FDAWAROLSA-N |
| XLogP | 7.64 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|