C18H16ClN3OS2 — CID 19630104
2-(4-aminophenyl)sulfanyl-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 19630104) has the molecular formula C18H16ClN3OS2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 19630104 |
| Molecular Formula | C18H16ClN3OS2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(Sc1ccc(N)cc1)C(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H16ClN3OS2/c1-11(25-15-8-6-14(20)7-9-15)17(23)22-18-21-16(10-24-18)12-2-4-13(19)5-3-12/h2-11H,20H2,1H3,(H,21,22,23) |
| InChIKey | UUOLAMLOFMVCHE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|