C20H19N3O2S — CID 9343463
6-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 9343463) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 6-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 9343463 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 6-[2-(4-ethoxyanilino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCOc1ccc(Nc2nc(-c3ccc4c(c3)CCC(=O)N4)cs2)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-2-25-16-7-5-15(6-8-16)21-20-23-18(12-26-20)14-3-9-17-13(11-14)4-10-19(24)22-17/h3,5-9,11-12H,2,4,10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | YMIVZOLTHGPVGK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |