C17H18N2O3S — CID 167917290
methyl 4-[2-(1-acetylpyrrolidin-3-yl)-1,3-thiazol-4-yl]benzoate (PubChem CID 167917290) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is methyl 4-[2-(1-acetylpyrrolidin-3-yl)-1,3-thiazol-4-yl]benzoate.
| Compound Name | methyl 4-[2-(1-acetylpyrrolidin-3-yl)-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 167917290 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 4-[2-(1-acetylpyrrolidin-3-yl)-1,3-thiazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2csc(C3CCN(C(C)=O)C3)n2)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-11(20)19-8-7-14(9-19)16-18-15(10-23-16)12-3-5-13(6-4-12)17(21)22-2/h3-6,10,14H,7-9H2,1-2H3 |
| InChIKey | JXUMKZMGNQOXLJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |