C16H14F2N2O4S — CID 51146281
ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 51146281) has the molecular formula C16H14F2N2O4S and a molecular weight of 368.36 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 51146281 |
| Molecular Formula | C16H14F2N2O4S |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)/C=C/c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C16H14F2N2O4S/c1-2-23-14(22)12-9-25-16(19-12)20-13(21)8-5-10-3-6-11(7-4-10)24-15(17)18/h3-9,15H,2H2,1H3,(H,19,20,21)/b8-5+ |
| InChIKey | VHEFIHXRXVHJCQ-VMPITWQZSA-N |
| XLogP | 3.57 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|