C22H18N2OS2 — CID 41028556
3-ethylsulfanyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 41028556) has the molecular formula C22H18N2OS2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-ethylsulfanyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-ethylsulfanyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41028556 |
| Molecular Formula | C22H18N2OS2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-ethylsulfanyl-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCSc1cccc(C(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)c1 |
| InChI | InChI=1S/C22H18N2OS2/c1-2-26-19-9-5-8-18(13-19)21(25)24-22-23-20(14-27-22)17-11-10-15-6-3-4-7-16(15)12-17/h3-14H,2H2,1H3,(H,23,24,25) |
| InChIKey | WFMTYZHLVRMMFE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |