C12H13N5OS — CID 62249664
N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide (PubChem CID 62249664) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62249664 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1ccnc(C(=O)Nc2nc(C3CC3)cs2)c1 |
| InChI | InChI=1S/C12H13N5OS/c13-17-8-3-4-14-9(5-8)11(18)16-12-15-10(6-19-12)7-1-2-7/h3-7H,1-2,13H2,(H,14,17)(H,15,16,18) |
| InChIKey | OWOBICJIRZCYMR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|