C14H16N4O2S — CID 154786029
2-amino-N-[4-(oxan-4-yl)-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 154786029) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-amino-N-[4-(oxan-4-yl)-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-amino-N-[4-(oxan-4-yl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 154786029 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-amino-N-[4-(oxan-4-yl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)Nc2nc(C3CCOCC3)cs2)ccn1 |
| InChI | InChI=1S/C14H16N4O2S/c15-12-7-10(1-4-16-12)13(19)18-14-17-11(8-21-14)9-2-5-20-6-3-9/h1,4,7-9H,2-3,5-6H2,(H2,15,16)(H,17,18,19) |
| InChIKey | IONZCVHCHBEZBH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |