C19H21FN2O2S — CID 18164911
N-[4-[cyclopropyl-[(4-fluorophenyl)methyl]amino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 18164911) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[4-[cyclopropyl-[(4-fluorophenyl)methyl]amino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[cyclopropyl-[(4-fluorophenyl)methyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 18164911 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[4-[cyclopropyl-[(4-fluorophenyl)methyl]amino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N(Cc1ccc(F)cc1)C1CC1)c1ccsc1 |
| InChI | InChI=1S/C19H21FN2O2S/c20-16-5-3-14(4-6-16)12-22(17-7-8-17)18(23)2-1-10-21-19(24)15-9-11-25-13-15/h3-6,9,11,13,17H,1-2,7-8,10,12H2,(H,21,24) |
| InChIKey | VWBGFVOLPZFHBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|