C21H29N5O5 — CID 121075232
3,4,5-trimethoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide (PubChem CID 121075232) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121075232 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCNc2nc(C)cc(N3CCOCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29N5O5/c1-14-11-18(26-7-9-31-10-8-26)25-21(24-14)23-6-5-22-20(27)15-12-16(28-2)19(30-4)17(13-15)29-3/h11-13H,5-10H2,1-4H3,(H,22,27)(H,23,24,25) |
| InChIKey | YKBFPJFWGSYDNN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|