C20H23N5O5 — CID 90491731
(E)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 90491731) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is (E)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90491731 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (E)-N-[2-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)oxyethyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | Cc1nc(OCCNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H23N5O5/c1-15-22-18(24-9-12-29-13-10-24)14-20(23-15)30-11-8-21-19(26)7-4-16-2-5-17(6-3-16)25(27)28/h2-7,14H,8-13H2,1H3,(H,21,26)/b7-4+ |
| InChIKey | HXIMWYNPKCHGCL-QPJJXVBHSA-N |
| XLogP | 1.74 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|