C18H20ClN5O4 — CID 90492130
2-chloro-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-5-nitrobenzamide (PubChem CID 90492130) has the molecular formula C18H20ClN5O4 and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 90492130 |
| Molecular Formula | C18H20ClN5O4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-chloro-N-[2-(2-methyl-6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]-5-nitrobenzamide |
| SMILES | Cc1nc(OCCNC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C18H20ClN5O4/c1-12-21-16(23-7-2-3-8-23)11-17(22-12)28-9-6-20-18(25)14-10-13(24(26)27)4-5-15(14)19/h4-5,10-11H,2-3,6-9H2,1H3,(H,20,25) |
| InChIKey | XAHKMYLDBOUXSW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|