C21H23ClF3N5O4 — CID 23152013
2-chloro-N-[3-[[6-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide (PubChem CID 23152013) has the molecular formula C21H23ClF3N5O4 and a molecular weight of 501.89 g/mol. Its IUPAC name is 2-chloro-N-[3-[[6-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-[[6-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 23152013 |
| Molecular Formula | C21H23ClF3N5O4 |
| Molecular Weight | 501.89 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-chloro-N-[3-[[6-(4-methylpiperazin-1-yl)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide |
| SMILES | CN1CCN(c2cc(C(F)(F)F)cc(OCCCNC(=O)c3cc([N+](=O)[O-])ccc3Cl)n2)CC1 |
| InChI | InChI=1S/C21H23ClF3N5O4/c1-28-6-8-29(9-7-28)18-11-14(21(23,24)25)12-19(27-18)34-10-2-5-26-20(31)16-13-15(30(32)33)3-4-17(16)22/h3-4,11-13H,2,5-10H2,1H3,(H,26,31) |
| InChIKey | QGAYBURPSWAAKM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|