C22H23F4N3O5 — CID 23152050
N-[3-[[6-(cyclopentylmethoxy)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide (PubChem CID 23152050) has the molecular formula C22H23F4N3O5 and a molecular weight of 485.43 g/mol. Its IUPAC name is N-[3-[[6-(cyclopentylmethoxy)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[3-[[6-(cyclopentylmethoxy)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 23152050 |
| Molecular Formula | C22H23F4N3O5 |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[3-[[6-(cyclopentylmethoxy)-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide |
| SMILES | O=C(NCCCOc1cc(C(F)(F)F)cc(OCC2CCCC2)n1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C22H23F4N3O5/c23-18-7-6-16(29(31)32)12-17(18)21(30)27-8-3-9-33-19-10-15(22(24,25)26)11-20(28-19)34-13-14-4-1-2-5-14/h6-7,10-12,14H,1-5,8-9,13H2,(H,27,30) |
| InChIKey | DHIGANGKJBNDPO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|