C20H21F4N3O5 — CID 23152054
N-[3-[[6-butoxy-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide (PubChem CID 23152054) has the molecular formula C20H21F4N3O5 and a molecular weight of 459.40 g/mol. Its IUPAC name is N-[3-[[6-butoxy-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[3-[[6-butoxy-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 23152054 |
| Molecular Formula | C20H21F4N3O5 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[3-[[6-butoxy-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-2-fluoro-5-nitrobenzamide |
| SMILES | CCCCOc1cc(C(F)(F)F)cc(OCCCNC(=O)c2cc([N+](=O)[O-])ccc2F)n1 |
| InChI | InChI=1S/C20H21F4N3O5/c1-2-3-8-31-17-10-13(20(22,23)24)11-18(26-17)32-9-4-7-25-19(28)15-12-14(27(29)30)5-6-16(15)21/h5-6,10-12H,2-4,7-9H2,1H3,(H,25,28) |
| InChIKey | GQSDYILDLYUWQB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|