C20H16F4N4O4 — CID 23151923
2-fluoro-5-nitro-N-[3-[[6-pyrrol-1-yl-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]benzamide (PubChem CID 23151923) has the molecular formula C20H16F4N4O4 and a molecular weight of 452.36 g/mol. Its IUPAC name is 2-fluoro-5-nitro-N-[3-[[6-pyrrol-1-yl-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]benzamide.
| Compound Name | 2-fluoro-5-nitro-N-[3-[[6-pyrrol-1-yl-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]benzamide |
|---|---|
| PubChem CID | 23151923 |
| Molecular Formula | C20H16F4N4O4 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-fluoro-5-nitro-N-[3-[[6-pyrrol-1-yl-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]benzamide |
| SMILES | O=C(NCCCOc1cc(C(F)(F)F)cc(-n2cccc2)n1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C20H16F4N4O4/c21-16-5-4-14(28(30)31)12-15(16)19(29)25-6-3-9-32-18-11-13(20(22,23)24)10-17(26-18)27-7-1-2-8-27/h1-2,4-5,7-8,10-12H,3,6,9H2,(H,25,29) |
| InChIKey | CDLFYKAKNAFUNH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|