C16H13Cl2F3N4O4 — CID 23151883
4-amino-2-chloro-N-[3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide (PubChem CID 23151883) has the molecular formula C16H13Cl2F3N4O4 and a molecular weight of 453.20 g/mol. Its IUPAC name is 4-amino-2-chloro-N-[3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide.
| Compound Name | 4-amino-2-chloro-N-[3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 23151883 |
| Molecular Formula | C16H13Cl2F3N4O4 |
| Molecular Weight | 453.20 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 4-amino-2-chloro-N-[3-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]oxy]propyl]-5-nitrobenzamide |
| SMILES | Nc1cc(Cl)c(C(=O)NCCCOc2cc(C(F)(F)F)cc(Cl)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13Cl2F3N4O4/c17-10-7-11(22)12(25(27)28)6-9(10)15(26)23-2-1-3-29-14-5-8(16(19,20)21)4-13(18)24-14/h4-7H,1-3,22H2,(H,23,26) |
| InChIKey | HBNPXJZFOIWTFY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|