C16H12Cl2F3N3O5S — CID 23151988
2-chloro-N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propyl]-5-nitrobenzamide (PubChem CID 23151988) has the molecular formula C16H12Cl2F3N3O5S and a molecular weight of 486.26 g/mol. Its IUPAC name is 2-chloro-N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 23151988 |
| Molecular Formula | C16H12Cl2F3N3O5S |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | 2-chloro-N-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propyl]-5-nitrobenzamide |
| SMILES | O=C(NCCCS(=O)(=O)c1ncc(C(F)(F)F)cc1Cl)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H12Cl2F3N3O5S/c17-12-3-2-10(24(26)27)7-11(12)14(25)22-4-1-5-30(28,29)15-13(18)6-9(8-23-15)16(19,20)21/h2-3,6-8H,1,4-5H2,(H,22,25) |
| InChIKey | WHZOHVQGJFHRQC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|