C17H13ClF6N4O3 — CID 23152020
N-[3-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]propyl]-2-chloro-5-nitrobenzamide (PubChem CID 23152020) has the molecular formula C17H13ClF6N4O3 and a molecular weight of 470.76 g/mol. Its IUPAC name is N-[3-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]propyl]-2-chloro-5-nitrobenzamide.
| Compound Name | N-[3-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]propyl]-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 23152020 |
| Molecular Formula | C17H13ClF6N4O3 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | N-[3-[[4,5-bis(trifluoromethyl)-2-pyridinyl]amino]propyl]-2-chloro-5-nitrobenzamide |
| SMILES | O=C(NCCCNc1cc(C(F)(F)F)c(C(F)(F)F)cn1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H13ClF6N4O3/c18-13-3-2-9(28(30)31)6-10(13)15(29)26-5-1-4-25-14-7-11(16(19,20)21)12(8-27-14)17(22,23)24/h2-3,6-8H,1,4-5H2,(H,25,27)(H,26,29) |
| InChIKey | MANACSRQBRWRND-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|